C25H19ClN2O4 — CID 175469924
N-[(3-chlorophenyl)methyl]-N-[4-(methylcarbamoyl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 175469924) has the molecular formula C25H19ClN2O4 and a molecular weight of 446.89 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-[4-(methylcarbamoyl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-[4-(methylcarbamoyl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 175469924 |
| Molecular Formula | C25H19ClN2O4 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-[4-(methylcarbamoyl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | CNC(=O)c1ccc(N(Cc2cccc(Cl)c2)C(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C25H19ClN2O4/c1-27-23(29)17-9-11-20(12-10-17)28(15-16-5-4-7-19(26)13-16)24(30)21-14-18-6-2-3-8-22(18)32-25(21)31/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | HTYQOQFJTGAOON-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|