C18H27N3O7 — CID 175471473
3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methoxypyrimidin-5-yl]propanoic acid (PubChem CID 175471473) has the molecular formula C18H27N3O7 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methoxypyrimidin-5-yl]propanoic acid.
| Compound Name | 3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methoxypyrimidin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 175471473 |
| Molecular Formula | C18H27N3O7 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methoxypyrimidin-5-yl]propanoic acid |
| SMILES | COc1nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ncc1CCC(=O)O |
| InChI | InChI=1S/C18H27N3O7/c1-17(2,3)27-15(24)21(16(25)28-18(4,5)6)14-19-10-11(8-9-12(22)23)13(20-14)26-7/h10H,8-9H2,1-7H3,(H,22,23) |
| InChIKey | KZCLBCQYHLZXMN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |