About 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate
3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate (PubChem CID 175472422) has the molecular formula C13H13BrN2O8
and a molecular weight of 405.16 g/mol. Its IUPAC name is 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate.
Molecular Properties
| Compound Name | 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate |
| PubChem CID | 175472422 |
| Molecular Formula | C13H13BrN2O8 |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate |
| SMILES | CCOC(=O)c1cnc(OC(=O)C(Br)C(=O)OCC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13BrN2O8/c1-3-22-11(17)7-5-8(16(20)21)10(15-6-7)24-13(19)9(14)12(18)23-4-2/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | KPFBEYYGCVLXOF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 134.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate?
The IUPAC name of 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate (CID 175472422) is 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate.
What is the SMILES notation for 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate?
The canonical SMILES for 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate is CCOC(=O)c1cnc(OC(=O)C(Br)C(=O)OCC)c([N+](=O)[O-])c1.
What is the InChIKey of 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate?
The InChIKey is KPFBEYYGCVLXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O8/c1-3-22-11(17)7-5-8(16(20)21)10(15-6-7)24-13(19)9(14)12(18)23-4-2/h5-6,9H,3-4H2,1-2H3.
What are the key properties of 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate?
3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate has a molecular weight of 405.16 g/mol, XLogP of 1.40, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(5-ethoxycarbonyl-3-nitro-2-pyridinyl) 1-O-ethyl 2-bromopropanedioate is sourced from PubChem (CID 175472422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).