About zinc;manganese(2+);phosphonato phosphate
zinc;manganese(2+);phosphonato phosphate (PubChem CID 175473755) has the molecular formula MnO7P2Zn
and a molecular weight of 294.27 g/mol. Its IUPAC name is zinc;manganese(2+);phosphonato phosphate.
Molecular Properties
| Compound Name | zinc;manganese(2+);phosphonato phosphate |
| PubChem CID | 175473755 |
| Molecular Formula | MnO7P2Zn |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 292.78 |
| IUPAC Name | zinc;manganese(2+);phosphonato phosphate |
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-].[Mn+2].[Zn+2] |
| InChI | InChI=1S/Mn.H4O7P2.Zn/c;1-8(2,3)7-9(4,5)6;/h;(H2,1,2,3)(H2,4,5,6);/q+2;;+2/p-4 |
| InChIKey | GPVHFVNUCXZFBX-UHFFFAOYSA-J |
| XLogP | -3.34 |
| TPSA | 135.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;manganese(2+);phosphonato phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;manganese(2+);phosphonato phosphate?
The IUPAC name of zinc;manganese(2+);phosphonato phosphate (CID 175473755) is zinc;manganese(2+);phosphonato phosphate.
What is the SMILES notation for zinc;manganese(2+);phosphonato phosphate?
The canonical SMILES for zinc;manganese(2+);phosphonato phosphate is O=P([O-])([O-])OP(=O)([O-])[O-].[Mn+2].[Zn+2].
What is the InChIKey of zinc;manganese(2+);phosphonato phosphate?
The InChIKey is GPVHFVNUCXZFBX-UHFFFAOYSA-J. The full InChI is InChI=1S/Mn.H4O7P2.Zn/c;1-8(2,3)7-9(4,5)6;/h;(H2,1,2,3)(H2,4,5,6);/q+2;;+2/p-4.
What are the key properties of zinc;manganese(2+);phosphonato phosphate?
zinc;manganese(2+);phosphonato phosphate has a molecular weight of 294.27 g/mol, XLogP of -3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;manganese(2+);phosphonato phosphate is sourced from PubChem (CID 175473755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).