C12H11F4NO — CID 175473804
1-(3-fluorophenyl)-3-(1,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 175473804) has the molecular formula C12H11F4NO and a molecular weight of 261.22 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(1,2,2-trifluoroethyl)pyrrolidin-2-one.
| Compound Name | 1-(3-fluorophenyl)-3-(1,2,2-trifluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 175473804 |
| Molecular Formula | C12H11F4NO |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(1,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | O=C1C(C(F)C(F)F)CCN1c1cccc(F)c1 |
| InChI | InChI=1S/C12H11F4NO/c13-7-2-1-3-8(6-7)17-5-4-9(12(17)18)10(14)11(15)16/h1-3,6,9-11H,4-5H2 |
| InChIKey | IDOXNCUKQMPTTJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |