C16H23N3O4S — CID 175474084
tert-butyl 2-(2-cyclopropylsulfonylpyrimidin-4-yl)pyrrolidine-1-carboxylate (PubChem CID 175474084) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is tert-butyl 2-(2-cyclopropylsulfonylpyrimidin-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-cyclopropylsulfonylpyrimidin-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175474084 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | tert-butyl 2-(2-cyclopropylsulfonylpyrimidin-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ccnc(S(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C16H23N3O4S/c1-16(2,3)23-15(20)19-10-4-5-13(19)12-8-9-17-14(18-12)24(21,22)11-6-7-11/h8-9,11,13H,4-7,10H2,1-3H3 |
| InChIKey | ATBFTJSPZSCCDP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |