About 3H-2-benzofuran-1-one;3-propyl-1H-indene
3H-2-benzofuran-1-one;3-propyl-1H-indene (PubChem CID 175475170) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 3H-2-benzofuran-1-one;3-propyl-1H-indene.
Molecular Properties
| Compound Name | 3H-2-benzofuran-1-one;3-propyl-1H-indene |
| PubChem CID | 175475170 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3H-2-benzofuran-1-one;3-propyl-1H-indene |
| SMILES | CCCC1=CCc2ccccc21.O=C1OCc2ccccc21 |
| InChI | InChI=1S/C12H14.C8H6O2/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;9-8-7-4-2-1-3-6(7)5-10-8/h3-4,6-8H,2,5,9H2,1H3;1-4H,5H2 |
| InChIKey | FLUPFDKIXXUCCI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-2-benzofuran-1-one;3-propyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-2-benzofuran-1-one;3-propyl-1H-indene?
The IUPAC name of 3H-2-benzofuran-1-one;3-propyl-1H-indene (CID 175475170) is 3H-2-benzofuran-1-one;3-propyl-1H-indene.
What is the SMILES notation for 3H-2-benzofuran-1-one;3-propyl-1H-indene?
The canonical SMILES for 3H-2-benzofuran-1-one;3-propyl-1H-indene is CCCC1=CCc2ccccc21.O=C1OCc2ccccc21.
What is the InChIKey of 3H-2-benzofuran-1-one;3-propyl-1H-indene?
The InChIKey is FLUPFDKIXXUCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C8H6O2/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;9-8-7-4-2-1-3-6(7)5-10-8/h3-4,6-8H,2,5,9H2,1H3;1-4H,5H2.
What are the key properties of 3H-2-benzofuran-1-one;3-propyl-1H-indene?
3H-2-benzofuran-1-one;3-propyl-1H-indene has a molecular weight of 292.38 g/mol, XLogP of 4.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-2-benzofuran-1-one;3-propyl-1H-indene is sourced from PubChem (CID 175475170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).