C18H23ClF3N3O4 — CID 175475678
tert-butyl 3-[(1R)-1-[2-chloro-5-(trifluoromethyl)pyridine-3-carbonyl]oxyethyl]piperazine-1-carboxylate (PubChem CID 175475678) has the molecular formula C18H23ClF3N3O4 and a molecular weight of 437.85 g/mol. Its IUPAC name is tert-butyl 3-[(1R)-1-[2-chloro-5-(trifluoromethyl)pyridine-3-carbonyl]oxyethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1R)-1-[2-chloro-5-(trifluoromethyl)pyridine-3-carbonyl]oxyethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175475678 |
| Molecular Formula | C18H23ClF3N3O4 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | tert-butyl 3-[(1R)-1-[2-chloro-5-(trifluoromethyl)pyridine-3-carbonyl]oxyethyl]piperazine-1-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc(C(F)(F)F)cnc1Cl)C1CN(C(=O)OC(C)(C)C)CCN1 |
| InChI | InChI=1S/C18H23ClF3N3O4/c1-10(13-9-25(6-5-23-13)16(27)29-17(2,3)4)28-15(26)12-7-11(18(20,21)22)8-24-14(12)19/h7-8,10,13,23H,5-6,9H2,1-4H3/t10-,13?/m1/s1 |
| InChIKey | CNTPSYQAGXAWIJ-VUUHIHSGSA-N |
| XLogP | 3.51 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|