C24H29NO4S — CID 175476808
4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]cyclohexane-1-carbaldehyde (PubChem CID 175476808) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is 4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 175476808 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[[4-(1,3-dihydroisoindol-2-ylmethyl)-2-methylsulfonylphenoxy]methyl]cyclohexane-1-carbaldehyde |
| SMILES | CS(=O)(=O)c1cc(CN2Cc3ccccc3C2)ccc1OCC1CCC(C=O)CC1 |
| InChI | InChI=1S/C24H29NO4S/c1-30(27,28)24-12-20(13-25-14-21-4-2-3-5-22(21)15-25)10-11-23(24)29-17-19-8-6-18(16-26)7-9-19/h2-5,10-12,16,18-19H,6-9,13-15,17H2,1H3 |
| InChIKey | VEWIKOZTZIHGMF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|