C38H30F16O3 — CID 175477024
4-[3,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]but-3-en-2-one;4-[3-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one;4-[4-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one (PubChem CID 175477024) has the molecular formula C38H30F16O3 and a molecular weight of 838.62 g/mol. Its IUPAC name is 4-[3,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]but-3-en-2-one;4-[3-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one;4-[4-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one.
| Compound Name | 4-[3,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]but-3-en-2-one;4-[3-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one;4-[4-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 175477024 |
| Molecular Formula | C38H30F16O3 |
| Molecular Weight | 838.62 g/mol |
| Exact Mass | 838.19 |
| IUPAC Name | 4-[3,5-bis(1,1,2,2,2-pentafluoroethyl)phenyl]but-3-en-2-one;4-[3-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one;4-[4-(1,2,2-trifluoroethyl)phenyl]but-3-en-2-one |
| SMILES | CC(=O)C=Cc1cc(C(F)(F)C(F)(F)F)cc(C(F)(F)C(F)(F)F)c1.CC(=O)C=Cc1ccc(C(F)C(F)F)cc1.CC(=O)C=Cc1cccc(C(F)C(F)F)c1 |
| InChI | InChI=1S/C14H8F10O.2C12H11F3O/c1-7(25)2-3-8-4-9(11(15,16)13(19,20)21)6-10(5-8)12(17,18)14(22,23)24;1-8(16)2-3-9-4-6-10(7-5-9)11(13)12(14)15;1-8(16)5-6-9-3-2-4-10(7-9)11(13)12(14)15/h2-6H,1H3;2*2-7,11-12H,1H3 |
| InChIKey | CWQFFMSORYDTCT-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.62 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|