C22H23NO2 — CID 175477264
2-(4-phenyl-3-pyrrolidin-1-ylphenyl)hex-4-ynoic acid (PubChem CID 175477264) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-(4-phenyl-3-pyrrolidin-1-ylphenyl)hex-4-ynoic acid.
| Compound Name | 2-(4-phenyl-3-pyrrolidin-1-ylphenyl)hex-4-ynoic acid |
|---|---|
| PubChem CID | 175477264 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-(4-phenyl-3-pyrrolidin-1-ylphenyl)hex-4-ynoic acid |
| SMILES | CC#CCC(C(=O)O)c1ccc(-c2ccccc2)c(N2CCCC2)c1 |
| InChI | InChI=1S/C22H23NO2/c1-2-3-11-20(22(24)25)18-12-13-19(17-9-5-4-6-10-17)21(16-18)23-14-7-8-15-23/h4-6,9-10,12-13,16,20H,7-8,11,14-15H2,1H3,(H,24,25) |
| InChIKey | FUWLUEMACUTNFB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|