About carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one
carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one (PubChem CID 175478973) has the molecular formula C8H14N2OS2
and a molecular weight of 218.35 g/mol. Its IUPAC name is carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one.
Molecular Properties
| Compound Name | carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one |
| PubChem CID | 175478973 |
| Molecular Formula | C8H14N2OS2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1CCCC1=O.NC(=S)S |
| InChI | InChI=1S/C7H11NO.CH3NS2/c1-2-5-8-6-3-4-7(8)9;2-1(3)4/h2H,1,3-6H2;(H3,2,3,4) |
| InChIKey | BPZGREVRQHDRMX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one?
The IUPAC name of carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one (CID 175478973) is carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one.
What is the SMILES notation for carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one?
The canonical SMILES for carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one is C=CCN1CCCC1=O.NC(=S)S.
What is the InChIKey of carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one?
The InChIKey is BPZGREVRQHDRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO.CH3NS2/c1-2-5-8-6-3-4-7(8)9;2-1(3)4/h2H,1,3-6H2;(H3,2,3,4).
What are the key properties of carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one?
carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one has a molecular weight of 218.35 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;1-prop-2-enylpyrrolidin-2-one is sourced from PubChem (CID 175478973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).