2-ethyl-6-methoxypyridine;formic acid

C9H13NO3 — CID 175480647

IUPAC2-ethyl-6-methoxypyridine;formic acid
SMILESCCc1cccc(OC)n1.O=CO
InChIInChI=1S/C8H11NO.CH2O2/c1-3-7-5-4-6-8(9-7)10-2;2-1-3/h4-6H,3H2,1-2H3;1H,(H,2,3)
InChIKeyAYADQLPUARVWLE-UHFFFAOYSA-N
MW183.21 g/mol
LogP1.35
Rot. Bonds2

About 2-ethyl-6-methoxypyridine;formic acid

2-ethyl-6-methoxypyridine;formic acid (PubChem CID 175480647) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-ethyl-6-methoxypyridine;formic acid.

Molecular Properties

Compound Name2-ethyl-6-methoxypyridine;formic acid
PubChem CID175480647
Molecular FormulaC9H13NO3
Molecular Weight183.21 g/mol
Exact Mass183.09
IUPAC Name2-ethyl-6-methoxypyridine;formic acid
SMILESCCc1cccc(OC)n1.O=CO
InChIInChI=1S/C8H11NO.CH2O2/c1-3-7-5-4-6-8(9-7)10-2;2-1-3/h4-6H,3H2,1-2H3;1H,(H,2,3)
InChIKeyAYADQLPUARVWLE-UHFFFAOYSA-N
XLogP1.35
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.21
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-ethyl-6-methoxypyridine;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-6-methoxypyridine;formic acid?
The IUPAC name of 2-ethyl-6-methoxypyridine;formic acid (CID 175480647) is 2-ethyl-6-methoxypyridine;formic acid.
What is the SMILES notation for 2-ethyl-6-methoxypyridine;formic acid?
The canonical SMILES for 2-ethyl-6-methoxypyridine;formic acid is CCc1cccc(OC)n1.O=CO.
What is the InChIKey of 2-ethyl-6-methoxypyridine;formic acid?
The InChIKey is AYADQLPUARVWLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.CH2O2/c1-3-7-5-4-6-8(9-7)10-2;2-1-3/h4-6H,3H2,1-2H3;1H,(H,2,3).
What are the key properties of 2-ethyl-6-methoxypyridine;formic acid?
2-ethyl-6-methoxypyridine;formic acid has a molecular weight of 183.21 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methoxypyridine;formic acid is sourced from PubChem (CID 175480647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).