About 2-ethoxy-6-ethylpyridine
2-ethoxy-6-ethylpyridine (PubChem CID 58662042) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-ethoxy-6-ethylpyridine.
Molecular Properties
| Compound Name | 2-ethoxy-6-ethylpyridine |
| PubChem CID | 58662042 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-ethoxy-6-ethylpyridine |
| SMILES | CCOc1cccc(CC)n1 |
| InChI | InChI=1S/C9H13NO/c1-3-8-6-5-7-9(10-8)11-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | JMNXDKLWYKIJDH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-6-ethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-ethylpyridine?
The IUPAC name of 2-ethoxy-6-ethylpyridine (CID 58662042) is 2-ethoxy-6-ethylpyridine.
What is the SMILES notation for 2-ethoxy-6-ethylpyridine?
The canonical SMILES for 2-ethoxy-6-ethylpyridine is CCOc1cccc(CC)n1.
What is the InChIKey of 2-ethoxy-6-ethylpyridine?
The InChIKey is JMNXDKLWYKIJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-8-6-5-7-9(10-8)11-4-2/h5-7H,3-4H2,1-2H3.
What are the key properties of 2-ethoxy-6-ethylpyridine?
2-ethoxy-6-ethylpyridine has a molecular weight of 151.21 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-ethylpyridine is sourced from PubChem (CID 58662042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).