About cyanamide;phosphoric acid;urea
cyanamide;phosphoric acid;urea (PubChem CID 175480992) has the molecular formula C2H9N4O5P
and a molecular weight of 200.09 g/mol. Its IUPAC name is cyanamide;phosphoric acid;urea.
Molecular Properties
| Compound Name | cyanamide;phosphoric acid;urea |
| PubChem CID | 175480992 |
| Molecular Formula | C2H9N4O5P |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | cyanamide;phosphoric acid;urea |
| SMILES | N#CN.NC(N)=O.O=P(O)(O)O |
| InChI | InChI=1S/CH4N2O.CH2N2.H3O4P/c2-1(3)4;2-1-3;1-5(2,3)4/h(H4,2,3,4);2H2;(H3,1,2,3,4) |
| InChIKey | RTERWQIXRCULJS-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 196.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyanamide;phosphoric acid;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanamide;phosphoric acid;urea?
The IUPAC name of cyanamide;phosphoric acid;urea (CID 175480992) is cyanamide;phosphoric acid;urea.
What is the SMILES notation for cyanamide;phosphoric acid;urea?
The canonical SMILES for cyanamide;phosphoric acid;urea is N#CN.NC(N)=O.O=P(O)(O)O.
What is the InChIKey of cyanamide;phosphoric acid;urea?
The InChIKey is RTERWQIXRCULJS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.CH2N2.H3O4P/c2-1(3)4;2-1-3;1-5(2,3)4/h(H4,2,3,4);2H2;(H3,1,2,3,4).
What are the key properties of cyanamide;phosphoric acid;urea?
cyanamide;phosphoric acid;urea has a molecular weight of 200.09 g/mol, XLogP of -2.48, 0 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanamide;phosphoric acid;urea is sourced from PubChem (CID 175480992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).