C17H16N4O6S2 — CID 175481819
3-[7-(4-methylphenyl)sulfonyloxy-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]pyrrolidine-1-carboxylic acid (PubChem CID 175481819) has the molecular formula C17H16N4O6S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-[7-(4-methylphenyl)sulfonyloxy-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[7-(4-methylphenyl)sulfonyloxy-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175481819 |
| Molecular Formula | C17H16N4O6S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 3-[7-(4-methylphenyl)sulfonyloxy-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-2-yl]pyrrolidine-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(=O)n3nc(C4CCN(C(=O)O)C4)sc3n2)cc1 |
| InChI | InChI=1S/C17H16N4O6S2/c1-10-2-4-12(5-3-10)29(25,26)27-13-8-14(22)21-16(18-13)28-15(19-21)11-6-7-20(9-11)17(23)24/h2-5,8,11H,6-7,9H2,1H3,(H,23,24) |
| InChIKey | PRZDCPZHABABOZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|