C24H31NO5S — CID 175389009
4-[2-methyl-1-[2-[(4-methylphenyl)sulfonyloxymethyl]phenyl]propan-2-yl]piperidine-1-carboxylic acid (PubChem CID 175389009) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-[2-methyl-1-[2-[(4-methylphenyl)sulfonyloxymethyl]phenyl]propan-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-methyl-1-[2-[(4-methylphenyl)sulfonyloxymethyl]phenyl]propan-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175389009 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[2-methyl-1-[2-[(4-methylphenyl)sulfonyloxymethyl]phenyl]propan-2-yl]piperidine-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccccc2CC(C)(C)C2CCN(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-18-8-10-22(11-9-18)31(28,29)30-17-20-7-5-4-6-19(20)16-24(2,3)21-12-14-25(15-13-21)23(26)27/h4-11,21H,12-17H2,1-3H3,(H,26,27) |
| InChIKey | SCUGFZWUPCMDQA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|