About sodium;hydride;prop-2-ynyl propane-1-sulfonate
sodium;hydride;prop-2-ynyl propane-1-sulfonate (PubChem CID 175482201) has the molecular formula C6H11NaO3S
and a molecular weight of 186.21 g/mol. Its IUPAC name is sodium;hydride;prop-2-ynyl propane-1-sulfonate.
Molecular Properties
| Compound Name | sodium;hydride;prop-2-ynyl propane-1-sulfonate |
| PubChem CID | 175482201 |
| Molecular Formula | C6H11NaO3S |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | sodium;hydride;prop-2-ynyl propane-1-sulfonate |
| SMILES | C#CCOS(=O)(=O)CCC.[H-].[Na+] |
| InChI | InChI=1S/C6H10O3S.Na.H/c1-3-5-9-10(7,8)6-4-2;;/h1H,4-6H2,2H3;;/q;+1;-1 |
| InChIKey | QOQZIJADRNQNDO-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;prop-2-ynyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;prop-2-ynyl propane-1-sulfonate?
The IUPAC name of sodium;hydride;prop-2-ynyl propane-1-sulfonate (CID 175482201) is sodium;hydride;prop-2-ynyl propane-1-sulfonate.
What is the SMILES notation for sodium;hydride;prop-2-ynyl propane-1-sulfonate?
The canonical SMILES for sodium;hydride;prop-2-ynyl propane-1-sulfonate is C#CCOS(=O)(=O)CCC.[H-].[Na+].
What is the InChIKey of sodium;hydride;prop-2-ynyl propane-1-sulfonate?
The InChIKey is QOQZIJADRNQNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S.Na.H/c1-3-5-9-10(7,8)6-4-2;;/h1H,4-6H2,2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;prop-2-ynyl propane-1-sulfonate?
sodium;hydride;prop-2-ynyl propane-1-sulfonate has a molecular weight of 186.21 g/mol, XLogP of -2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;prop-2-ynyl propane-1-sulfonate is sourced from PubChem (CID 175482201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).