About lithium;hydride;methyl fluorosulfonylformate
lithium;hydride;methyl fluorosulfonylformate (PubChem CID 175482440) has the molecular formula C2H4FLiO4S
and a molecular weight of 150.06 g/mol. Its IUPAC name is lithium;hydride;methyl fluorosulfonylformate.
Molecular Properties
| Compound Name | lithium;hydride;methyl fluorosulfonylformate |
| PubChem CID | 175482440 |
| Molecular Formula | C2H4FLiO4S |
| Molecular Weight | 150.06 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | lithium;hydride;methyl fluorosulfonylformate |
| SMILES | COC(=O)S(=O)(=O)F.[H-].[Li+] |
| InChI | InChI=1S/C2H3FO4S.Li.H/c1-7-2(4)8(3,5)6;;/h1H3;;/q;+1;-1 |
| InChIKey | OQPZEZZWMZMLFX-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.06 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;methyl fluorosulfonylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;methyl fluorosulfonylformate?
The IUPAC name of lithium;hydride;methyl fluorosulfonylformate (CID 175482440) is lithium;hydride;methyl fluorosulfonylformate.
What is the SMILES notation for lithium;hydride;methyl fluorosulfonylformate?
The canonical SMILES for lithium;hydride;methyl fluorosulfonylformate is COC(=O)S(=O)(=O)F.[H-].[Li+].
What is the InChIKey of lithium;hydride;methyl fluorosulfonylformate?
The InChIKey is OQPZEZZWMZMLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3FO4S.Li.H/c1-7-2(4)8(3,5)6;;/h1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;methyl fluorosulfonylformate?
lithium;hydride;methyl fluorosulfonylformate has a molecular weight of 150.06 g/mol, XLogP of -2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;methyl fluorosulfonylformate is sourced from PubChem (CID 175482440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).