C24H54NO3PS — CID 175487759
N,N-dioctyloctan-1-amine;trihydroxy(sulfanylidene)-λ5-phosphane (PubChem CID 175487759) has the molecular formula C24H54NO3PS and a molecular weight of 467.74 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;trihydroxy(sulfanylidene)-λ5-phosphane.
| Compound Name | N,N-dioctyloctan-1-amine;trihydroxy(sulfanylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 175487759 |
| Molecular Formula | C24H54NO3PS |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.36 |
| IUPAC Name | N,N-dioctyloctan-1-amine;trihydroxy(sulfanylidene)-λ5-phosphane |
| SMILES | CCCCCCCCN(CCCCCCCC)CCCCCCCC.OP(O)(O)=S |
| InChI | InChI=1S/C24H51N.H3O3PS/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-4(2,3)5/h4-24H2,1-3H3;(H3,1,2,3,5) |
| InChIKey | OYRJLNXWXMQVJY-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|