About butane;N-(3-methylheptyl)formamide;phosphoric acid
butane;N-(3-methylheptyl)formamide;phosphoric acid (PubChem CID 175488083) has the molecular formula C13H38NO13P3
and a molecular weight of 509.36 g/mol. Its IUPAC name is butane;N-(3-methylheptyl)formamide;phosphoric acid.
Molecular Properties
| Compound Name | butane;N-(3-methylheptyl)formamide;phosphoric acid |
| PubChem CID | 175488083 |
| Molecular Formula | C13H38NO13P3 |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | butane;N-(3-methylheptyl)formamide;phosphoric acid |
| SMILES | CCCC.CCCCC(C)CCNC=O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C9H19NO.C4H10.3H3O4P/c1-3-4-5-9(2)6-7-10-8-11;1-3-4-2;3*1-5(2,3)4/h8-9H,3-7H2,1-2H3,(H,10,11);3-4H2,1-2H3;3*(H3,1,2,3,4) |
| InChIKey | DKNDONZYDVDPCS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 262.38 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butane;N-(3-methylheptyl)formamide;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N-(3-methylheptyl)formamide;phosphoric acid?
The IUPAC name of butane;N-(3-methylheptyl)formamide;phosphoric acid (CID 175488083) is butane;N-(3-methylheptyl)formamide;phosphoric acid.
What is the SMILES notation for butane;N-(3-methylheptyl)formamide;phosphoric acid?
The canonical SMILES for butane;N-(3-methylheptyl)formamide;phosphoric acid is CCCC.CCCCC(C)CCNC=O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O.
What is the InChIKey of butane;N-(3-methylheptyl)formamide;phosphoric acid?
The InChIKey is DKNDONZYDVDPCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C4H10.3H3O4P/c1-3-4-5-9(2)6-7-10-8-11;1-3-4-2;3*1-5(2,3)4/h8-9H,3-7H2,1-2H3,(H,10,11);3-4H2,1-2H3;3*(H3,1,2,3,4).
What are the key properties of butane;N-(3-methylheptyl)formamide;phosphoric acid?
butane;N-(3-methylheptyl)formamide;phosphoric acid has a molecular weight of 509.36 g/mol, XLogP of 0.97, 8 rotatable bonds, 10 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N-(3-methylheptyl)formamide;phosphoric acid is sourced from PubChem (CID 175488083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).