C9H16N2O2 — CID 175488426
(1-prop-1-enylpiperidin-3-yl) carbamate (PubChem CID 175488426) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (1-prop-1-enylpiperidin-3-yl) carbamate.
| Compound Name | (1-prop-1-enylpiperidin-3-yl) carbamate |
|---|---|
| PubChem CID | 175488426 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (1-prop-1-enylpiperidin-3-yl) carbamate |
| SMILES | CC=CN1CCCC(OC(N)=O)C1 |
| InChI | InChI=1S/C9H16N2O2/c1-2-5-11-6-3-4-8(7-11)13-9(10)12/h2,5,8H,3-4,6-7H2,1H3,(H2,10,12) |
| InChIKey | QDBKAQXUPQJQMO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |