C23H30N2O4S — CID 175489051
2-[2-[2-[[3-(ethylsulfonylamino)pyrrolidin-2-yl]methyl]phenyl]phenyl]butanoic acid (PubChem CID 175489051) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-[2-[2-[[3-(ethylsulfonylamino)pyrrolidin-2-yl]methyl]phenyl]phenyl]butanoic acid.
| Compound Name | 2-[2-[2-[[3-(ethylsulfonylamino)pyrrolidin-2-yl]methyl]phenyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 175489051 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[2-[2-[[3-(ethylsulfonylamino)pyrrolidin-2-yl]methyl]phenyl]phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccccc1-c1ccccc1CC1NCCC1NS(=O)(=O)CC |
| InChI | InChI=1S/C23H30N2O4S/c1-3-17(23(26)27)19-11-7-8-12-20(19)18-10-6-5-9-16(18)15-22-21(13-14-24-22)25-30(28,29)4-2/h5-12,17,21-22,24-25H,3-4,13-15H2,1-2H3,(H,26,27) |
| InChIKey | FPRAFNJWKHUDPI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |