C14H19NO4S — CID 104571930
2-[2-(cyclopropylsulfamoyl)phenyl]pentanoic acid (PubChem CID 104571930) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfamoyl)phenyl]pentanoic acid.
| Compound Name | 2-[2-(cyclopropylsulfamoyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 104571930 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[2-(cyclopropylsulfamoyl)phenyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1ccccc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C14H19NO4S/c1-2-5-12(14(16)17)11-6-3-4-7-13(11)20(18,19)15-10-8-9-10/h3-4,6-7,10,12,15H,2,5,8-9H2,1H3,(H,16,17) |
| InChIKey | YLHYIDQBZDDHPL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |