C14H20ClNO2S — CID 55220897
2-(3-chloropentan-2-yl)-N-cyclopropylbenzenesulfonamide (PubChem CID 55220897) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is 2-(3-chloropentan-2-yl)-N-cyclopropylbenzenesulfonamide.
| Compound Name | 2-(3-chloropentan-2-yl)-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 55220897 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(3-chloropentan-2-yl)-N-cyclopropylbenzenesulfonamide |
| SMILES | CCC(Cl)C(C)c1ccccc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C14H20ClNO2S/c1-3-13(15)10(2)12-6-4-5-7-14(12)19(17,18)16-11-8-9-11/h4-7,10-11,13,16H,3,8-9H2,1-2H3 |
| InChIKey | PSHVXQAJRJHTDF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|