C26H30F3N3OSi — CID 175489065
N-[3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-(2-trimethylsilylethynyl)benzamide (PubChem CID 175489065) has the molecular formula C26H30F3N3OSi and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-(2-trimethylsilylethynyl)benzamide.
| Compound Name | N-[3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-(2-trimethylsilylethynyl)benzamide |
|---|---|
| PubChem CID | 175489065 |
| Molecular Formula | C26H30F3N3OSi |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-(2-trimethylsilylethynyl)benzamide |
| SMILES | CN1CCN(C2CC(F)(F)c3cc(NC(=O)c4ccc(F)c(C#C[Si](C)(C)C)c4)ccc32)CC1 |
| InChI | InChI=1S/C26H30F3N3OSi/c1-31-10-12-32(13-11-31)24-17-26(28,29)22-16-20(6-7-21(22)24)30-25(33)19-5-8-23(27)18(15-19)9-14-34(2,3)4/h5-8,15-16,24H,10-13,17H2,1-4H3,(H,30,33) |
| InChIKey | MFTLSJPLWDCQRY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|