C21H21F3IN3O — CID 175489104
N-[(1S)-3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-iodobenzamide (PubChem CID 175489104) has the molecular formula C21H21F3IN3O and a molecular weight of 515.32 g/mol. Its IUPAC name is N-[(1S)-3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-iodobenzamide.
| Compound Name | N-[(1S)-3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-iodobenzamide |
|---|---|
| PubChem CID | 175489104 |
| Molecular Formula | C21H21F3IN3O |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | N-[(1S)-3,3-difluoro-1-(4-methylpiperazin-1-yl)-1,2-dihydroinden-5-yl]-4-fluoro-3-iodobenzamide |
| SMILES | CN1CCN([C@H]2CC(F)(F)c3cc(NC(=O)c4ccc(F)c(I)c4)ccc32)CC1 |
| InChI | InChI=1S/C21H21F3IN3O/c1-27-6-8-28(9-7-27)19-12-21(23,24)16-11-14(3-4-15(16)19)26-20(29)13-2-5-17(22)18(25)10-13/h2-5,10-11,19H,6-9,12H2,1H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | OKUPJHPTAIGZKI-IBGZPJMESA-N |
| XLogP | 4.47 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|