C19H23BFN3O3 — CID 18960619
[4-[[4-fluoro-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-2-methylphenyl]boronic acid (PubChem CID 18960619) has the molecular formula C19H23BFN3O3 and a molecular weight of 371.22 g/mol. Its IUPAC name is [4-[[4-fluoro-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-2-methylphenyl]boronic acid.
| Compound Name | [4-[[4-fluoro-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 18960619 |
| Molecular Formula | C19H23BFN3O3 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [4-[[4-fluoro-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]-2-methylphenyl]boronic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(F)c(N3CCN(C)CC3)c2)ccc1B(O)O |
| InChI | InChI=1S/C19H23BFN3O3/c1-13-11-14(3-5-16(13)20(26)27)19(25)22-15-4-6-17(21)18(12-15)24-9-7-23(2)8-10-24/h3-6,11-12,26-27H,7-10H2,1-2H3,(H,22,25) |
| InChIKey | FFUNUQNIGKBGKA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|