C20H23BrFN3O2 — CID 22414575
4-bromo-N-[2-fluoro-4-methoxy-5-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide (PubChem CID 22414575) has the molecular formula C20H23BrFN3O2 and a molecular weight of 436.33 g/mol. Its IUPAC name is 4-bromo-N-[2-fluoro-4-methoxy-5-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide.
| Compound Name | 4-bromo-N-[2-fluoro-4-methoxy-5-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 22414575 |
| Molecular Formula | C20H23BrFN3O2 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 4-bromo-N-[2-fluoro-4-methoxy-5-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide |
| SMILES | COc1cc(F)c(NC(=O)c2ccc(Br)c(C)c2)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C20H23BrFN3O2/c1-13-10-14(4-5-15(13)21)20(26)23-17-12-18(19(27-3)11-16(17)22)25-8-6-24(2)7-9-25/h4-5,10-12H,6-9H2,1-3H3,(H,23,26) |
| InChIKey | CHNXVCWALQBQHD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |