C28H30BrN3O6 — CID 44533134
N-[3-(4-benzylpiperazin-1-yl)-4-methoxyphenyl]-4-bromo-3-methylbenzamide;oxalic acid (PubChem CID 44533134) has the molecular formula C28H30BrN3O6 and a molecular weight of 584.47 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)-4-methoxyphenyl]-4-bromo-3-methylbenzamide;oxalic acid.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)-4-methoxyphenyl]-4-bromo-3-methylbenzamide;oxalic acid |
|---|---|
| PubChem CID | 44533134 |
| Molecular Formula | C28H30BrN3O6 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)-4-methoxyphenyl]-4-bromo-3-methylbenzamide;oxalic acid |
| SMILES | COc1ccc(NC(=O)c2ccc(Br)c(C)c2)cc1N1CCN(Cc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H28BrN3O2.C2H2O4/c1-19-16-21(8-10-23(19)27)26(31)28-22-9-11-25(32-2)24(17-22)30-14-12-29(13-15-30)18-20-6-4-3-5-7-20;3-1(4)2(5)6/h3-11,16-17H,12-15,18H2,1-2H3,(H,28,31);(H,3,4)(H,5,6) |
| InChIKey | FYBZSXWLEUPHLC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|