C28H32N4O6 — CID 22459304
N-[3-(4-ethylpiperazin-1-yl)-4-methoxyphenyl]-3-methyl-4-pyridin-4-ylbenzamide;oxalic acid (PubChem CID 22459304) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)-4-methoxyphenyl]-3-methyl-4-pyridin-4-ylbenzamide;oxalic acid.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)-4-methoxyphenyl]-3-methyl-4-pyridin-4-ylbenzamide;oxalic acid |
|---|---|
| PubChem CID | 22459304 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)-4-methoxyphenyl]-3-methyl-4-pyridin-4-ylbenzamide;oxalic acid |
| SMILES | CCN1CCN(c2cc(NC(=O)c3ccc(-c4ccncc4)c(C)c3)ccc2OC)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H30N4O2.C2H2O4/c1-4-29-13-15-30(16-14-29)24-18-22(6-8-25(24)32-3)28-26(31)21-5-7-23(19(2)17-21)20-9-11-27-12-10-20;3-1(4)2(5)6/h5-12,17-18H,4,13-16H2,1-3H3,(H,28,31);(H,3,4)(H,5,6) |
| InChIKey | RVUUOXGHCRLKCN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|