C32H36N4O7 — CID 159842364
but-2-enedioic acid;4-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide (PubChem CID 159842364) has the molecular formula C32H36N4O7 and a molecular weight of 588.66 g/mol. Its IUPAC name is but-2-enedioic acid;4-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide.
| Compound Name | but-2-enedioic acid;4-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 159842364 |
| Molecular Formula | C32H36N4O7 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | but-2-enedioic acid;4-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(C(C)=NO)cc3)c(C)c2)cc1N1CCN(C)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C28H32N4O3.C4H4O4/c1-19-17-23(9-11-25(19)22-7-5-21(6-8-22)20(2)30-34)28(33)29-24-10-12-27(35-4)26(18-24)32-15-13-31(3)14-16-32;5-3(6)1-2-4(7)8/h5-12,17-18,34H,13-16H2,1-4H3,(H,29,33);1-2H,(H,5,6)(H,7,8) |
| InChIKey | NOVMMYWMKQVBKG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|