C32H35N5O3 — CID 143419282
4-[2-amino-3-[amino(hydroxy)methyl]-5-phenylphenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 143419282) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is 4-[2-amino-3-[amino(hydroxy)methyl]-5-phenylphenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 4-[2-amino-3-[amino(hydroxy)methyl]-5-phenylphenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 143419282 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-[2-amino-3-[amino(hydroxy)methyl]-5-phenylphenyl]-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cc(-c4ccccc4)cc(C(N)O)c3N)cc2)cc1N1CCN(C)CC1 |
| InChI | InChI=1S/C32H35N5O3/c1-36-14-16-37(17-15-36)28-20-25(12-13-29(28)40-2)35-32(39)23-10-8-22(9-11-23)26-18-24(21-6-4-3-5-7-21)19-27(30(26)33)31(34)38/h3-13,18-20,31,38H,14-17,33-34H2,1-2H3,(H,35,39) |
| InChIKey | QKRPINPEXHSZGX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|