C47H60N6O10 — CID 44533107
N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[7-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenoxy]heptoxy]benzamide;oxalic acid (PubChem CID 44533107) has the molecular formula C47H60N6O10 and a molecular weight of 869.03 g/mol. Its IUPAC name is N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[7-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenoxy]heptoxy]benzamide;oxalic acid.
| Compound Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[7-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenoxy]heptoxy]benzamide;oxalic acid |
|---|---|
| PubChem CID | 44533107 |
| Molecular Formula | C47H60N6O10 |
| Molecular Weight | 869.03 g/mol |
| Exact Mass | 868.44 |
| IUPAC Name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[7-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenoxy]heptoxy]benzamide;oxalic acid |
| SMILES | COc1ccc(NC(=O)c2ccc(OCCCCCCCOc3ccc(C(=O)Nc4ccc(OC)c(N5CCN(C)CC5)c4)cc3)cc2)cc1N1CCN(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C45H58N6O6.C2H2O4/c1-48-22-26-50(27-23-48)40-32-36(14-20-42(40)54-3)46-44(52)34-10-16-38(17-11-34)56-30-8-6-5-7-9-31-57-39-18-12-35(13-19-39)45(53)47-37-15-21-43(55-4)41(33-37)51-28-24-49(2)25-29-51;3-1(4)2(5)6/h10-21,32-33H,5-9,22-31H2,1-4H3,(H,46,52)(H,47,53);(H,3,4)(H,5,6) |
| InChIKey | RJUOIXDSZMGDBH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 182.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.03 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|