C22H27BrN4O2 — CID 2925551
N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-bromo-3-methylphenyl)oxamide (PubChem CID 2925551) has the molecular formula C22H27BrN4O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-bromo-3-methylphenyl)oxamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-bromo-3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 2925551 |
| Molecular Formula | C22H27BrN4O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-bromo-3-methylphenyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCCN2CCN(Cc3ccccc3)CC2)ccc1Br |
| InChI | InChI=1S/C22H27BrN4O2/c1-17-15-19(7-8-20(17)23)25-22(29)21(28)24-9-10-26-11-13-27(14-12-26)16-18-5-3-2-4-6-18/h2-8,15H,9-14,16H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | WJLQVYHQGJMRSK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|