C28H34O2P+ — CID 175489765
1,1-diethoxyhex-2-enyl(triphenyl)phosphanium (PubChem CID 175489765) has the molecular formula C28H34O2P+ and a molecular weight of 433.55 g/mol. Its IUPAC name is 1,1-diethoxyhex-2-enyl(triphenyl)phosphanium.
| Compound Name | 1,1-diethoxyhex-2-enyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 175489765 |
| Molecular Formula | C28H34O2P+ |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1,1-diethoxyhex-2-enyl(triphenyl)phosphanium |
| SMILES | CCCC=CC(OCC)(OCC)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O2P/c1-4-7-17-24-28(29-5-2,30-6-3)31(25-18-11-8-12-19-25,26-20-13-9-14-21-26)27-22-15-10-16-23-27/h8-24H,4-7H2,1-3H3/q+1 |
| InChIKey | JJFVTCRGUDALRS-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|