C26H25ClFN3O — CID 175490840
2-[4-[(1-but-2-ynylimidazol-2-yl)methyl]cyclohexen-1-yl]-6-[(4-chloro-2-fluorophenyl)methoxy]pyridine (PubChem CID 175490840) has the molecular formula C26H25ClFN3O and a molecular weight of 449.96 g/mol. Its IUPAC name is 2-[4-[(1-but-2-ynylimidazol-2-yl)methyl]cyclohexen-1-yl]-6-[(4-chloro-2-fluorophenyl)methoxy]pyridine.
| Compound Name | 2-[4-[(1-but-2-ynylimidazol-2-yl)methyl]cyclohexen-1-yl]-6-[(4-chloro-2-fluorophenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 175490840 |
| Molecular Formula | C26H25ClFN3O |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-[4-[(1-but-2-ynylimidazol-2-yl)methyl]cyclohexen-1-yl]-6-[(4-chloro-2-fluorophenyl)methoxy]pyridine |
| SMILES | CC#CCn1ccnc1CC1CC=C(c2cccc(OCc3ccc(Cl)cc3F)n2)CC1 |
| InChI | InChI=1S/C26H25ClFN3O/c1-2-3-14-31-15-13-29-25(31)16-19-7-9-20(10-8-19)24-5-4-6-26(30-24)32-18-21-11-12-22(27)17-23(21)28/h4-6,9,11-13,15,17,19H,7-8,10,14,16,18H2,1H3 |
| InChIKey | IKPAEJYASGDUGZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|