About dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate
dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate (PubChem CID 175492234) has the molecular formula C7H6BF3O6
and a molecular weight of 253.93 g/mol. Its IUPAC name is dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate.
Molecular Properties
| Compound Name | dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate |
| PubChem CID | 175492234 |
| Molecular Formula | C7H6BF3O6 |
| Molecular Weight | 253.93 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate |
| SMILES | OOB(OO)Oc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C7H6BF3O6/c9-7(10,11)4-1-2-5(12)6(3-4)15-8(16-13)17-14/h1-3,12-14H |
| InChIKey | FTWRLOOSSQBRIW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.93 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate?
The IUPAC name of dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate (CID 175492234) is dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate.
What is the SMILES notation for dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate?
The canonical SMILES for dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate is OOB(OO)Oc1cc(C(F)(F)F)ccc1O.
What is the InChIKey of dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate?
The InChIKey is FTWRLOOSSQBRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BF3O6/c9-7(10,11)4-1-2-5(12)6(3-4)15-8(16-13)17-14/h1-3,12-14H.
What are the key properties of dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate?
dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate has a molecular weight of 253.93 g/mol, XLogP of 1.75, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy [2-hydroxy-5-(trifluoromethyl)phenyl] borate is sourced from PubChem (CID 175492234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).