About oct-3-ynyl pentanoate
oct-3-ynyl pentanoate (PubChem CID 175496394) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is oct-3-ynyl pentanoate.
Molecular Properties
| Compound Name | oct-3-ynyl pentanoate |
| PubChem CID | 175496394 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | oct-3-ynyl pentanoate |
| SMILES | CCCCC#CCCOC(=O)CCCC |
| InChI | InChI=1S/C13H22O2/c1-3-5-7-8-9-10-12-15-13(14)11-6-4-2/h3-7,10-12H2,1-2H3 |
| InChIKey | SUMXWJGKANQIBL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-3-ynyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-3-ynyl pentanoate?
The IUPAC name of oct-3-ynyl pentanoate (CID 175496394) is oct-3-ynyl pentanoate.
What is the SMILES notation for oct-3-ynyl pentanoate?
The canonical SMILES for oct-3-ynyl pentanoate is CCCCC#CCCOC(=O)CCCC.
What is the InChIKey of oct-3-ynyl pentanoate?
The InChIKey is SUMXWJGKANQIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-3-5-7-8-9-10-12-15-13(14)11-6-4-2/h3-7,10-12H2,1-2H3.
What are the key properties of oct-3-ynyl pentanoate?
oct-3-ynyl pentanoate has a molecular weight of 210.32 g/mol, XLogP of 3.30, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-3-ynyl pentanoate is sourced from PubChem (CID 175496394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).