About oct-3-ynyl 2-bromoacetate
oct-3-ynyl 2-bromoacetate (PubChem CID 54084086) has the molecular formula C10H15BrO2
and a molecular weight of 247.13 g/mol. Its IUPAC name is oct-3-ynyl 2-bromoacetate.
Molecular Properties
| Compound Name | oct-3-ynyl 2-bromoacetate |
| PubChem CID | 54084086 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | oct-3-ynyl 2-bromoacetate |
| SMILES | CCCCC#CCCOC(=O)CBr |
| InChI | InChI=1S/C10H15BrO2/c1-2-3-4-5-6-7-8-13-10(12)9-11/h2-4,7-9H2,1H3 |
| InChIKey | MPELCTZZAIABFR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-3-ynyl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-3-ynyl 2-bromoacetate?
The IUPAC name of oct-3-ynyl 2-bromoacetate (CID 54084086) is oct-3-ynyl 2-bromoacetate.
What is the SMILES notation for oct-3-ynyl 2-bromoacetate?
The canonical SMILES for oct-3-ynyl 2-bromoacetate is CCCCC#CCCOC(=O)CBr.
What is the InChIKey of oct-3-ynyl 2-bromoacetate?
The InChIKey is MPELCTZZAIABFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrO2/c1-2-3-4-5-6-7-8-13-10(12)9-11/h2-4,7-9H2,1H3.
What are the key properties of oct-3-ynyl 2-bromoacetate?
oct-3-ynyl 2-bromoacetate has a molecular weight of 247.13 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-3-ynyl 2-bromoacetate is sourced from PubChem (CID 54084086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).