About 3-butoxypropyl 2-bromoacetate
3-butoxypropyl 2-bromoacetate (PubChem CID 139661180) has the molecular formula C9H17BrO3
and a molecular weight of 253.14 g/mol. Its IUPAC name is 3-butoxypropyl 2-bromoacetate.
Molecular Properties
| Compound Name | 3-butoxypropyl 2-bromoacetate |
| PubChem CID | 139661180 |
| Molecular Formula | C9H17BrO3 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-butoxypropyl 2-bromoacetate |
| SMILES | CCCCOCCCOC(=O)CBr |
| InChI | InChI=1S/C9H17BrO3/c1-2-3-5-12-6-4-7-13-9(11)8-10/h2-8H2,1H3 |
| InChIKey | RAEBFYHOZHNBKS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxypropyl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxypropyl 2-bromoacetate?
The IUPAC name of 3-butoxypropyl 2-bromoacetate (CID 139661180) is 3-butoxypropyl 2-bromoacetate.
What is the SMILES notation for 3-butoxypropyl 2-bromoacetate?
The canonical SMILES for 3-butoxypropyl 2-bromoacetate is CCCCOCCCOC(=O)CBr.
What is the InChIKey of 3-butoxypropyl 2-bromoacetate?
The InChIKey is RAEBFYHOZHNBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrO3/c1-2-3-5-12-6-4-7-13-9(11)8-10/h2-8H2,1H3.
What are the key properties of 3-butoxypropyl 2-bromoacetate?
3-butoxypropyl 2-bromoacetate has a molecular weight of 253.14 g/mol, XLogP of 2.13, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxypropyl 2-bromoacetate is sourced from PubChem (CID 139661180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).