C16H23BrFN3O3 — CID 175497460
tert-butyl 3-[(6-bromo-3-fluoro-2-pyridinyl)methoxymethyl]piperazine-1-carboxylate (PubChem CID 175497460) has the molecular formula C16H23BrFN3O3 and a molecular weight of 404.28 g/mol. Its IUPAC name is tert-butyl 3-[(6-bromo-3-fluoro-2-pyridinyl)methoxymethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-bromo-3-fluoro-2-pyridinyl)methoxymethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175497460 |
| Molecular Formula | C16H23BrFN3O3 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | tert-butyl 3-[(6-bromo-3-fluoro-2-pyridinyl)methoxymethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(COCc2nc(Br)ccc2F)C1 |
| InChI | InChI=1S/C16H23BrFN3O3/c1-16(2,3)24-15(22)21-7-6-19-11(8-21)9-23-10-13-12(18)4-5-14(17)20-13/h4-5,11,19H,6-10H2,1-3H3 |
| InChIKey | YKPSDXUPKFQRCX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|