About [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate
[2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate (PubChem CID 175499480) has the molecular formula C13H12BrF2N3O3S
and a molecular weight of 408.22 g/mol. Its IUPAC name is [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate.
Molecular Properties
| Compound Name | [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate |
| PubChem CID | 175499480 |
| Molecular Formula | C13H12BrF2N3O3S |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate |
| SMILES | NC(=O)OCC(Cn1ccn(Cc2ccc(Br)s2)c1=O)=C(F)F |
| InChI | InChI=1S/C13H12BrF2N3O3S/c14-10-2-1-9(23-10)6-19-4-3-18(13(19)21)5-8(11(15)16)7-22-12(17)20/h1-4H,5-7H2,(H2,17,20) |
| InChIKey | BEUQORYOIPCGIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate?
The IUPAC name of [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate (CID 175499480) is [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate.
What is the SMILES notation for [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate?
The canonical SMILES for [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate is NC(=O)OCC(Cn1ccn(Cc2ccc(Br)s2)c1=O)=C(F)F.
What is the InChIKey of [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate?
The InChIKey is BEUQORYOIPCGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrF2N3O3S/c14-10-2-1-9(23-10)6-19-4-3-18(13(19)21)5-8(11(15)16)7-22-12(17)20/h1-4H,5-7H2,(H2,17,20).
What are the key properties of [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate?
[2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate has a molecular weight of 408.22 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[3-[(5-bromothiophen-2-yl)methyl]-2-oxoimidazol-1-yl]methyl]-3,3-difluoroprop-2-enyl] carbamate is sourced from PubChem (CID 175499480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).