C16H24O8 — CID 175499778
(Z)-2,3-bis(4-ethoxy-4-oxobutan-2-yl)but-2-enedioic acid (PubChem CID 175499778) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is (Z)-2,3-bis(4-ethoxy-4-oxobutan-2-yl)but-2-enedioic acid.
| Compound Name | (Z)-2,3-bis(4-ethoxy-4-oxobutan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 175499778 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (Z)-2,3-bis(4-ethoxy-4-oxobutan-2-yl)but-2-enedioic acid |
| SMILES | CCOC(=O)CC(C)/C(C(=O)O)=C(/C(=O)O)C(C)CC(=O)OCC |
| InChI | InChI=1S/C16H24O8/c1-5-23-11(17)7-9(3)13(15(19)20)14(16(21)22)10(4)8-12(18)24-6-2/h9-10H,5-8H2,1-4H3,(H,19,20)(H,21,22)/b14-13- |
| InChIKey | CICXIFPSUJGGGR-YPKPFQOOSA-N |
| XLogP | 1.63 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|