C9H12O6 — CID 101281405
2-(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid (PubChem CID 101281405) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 101281405 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C9H12O6/c1-3-15-7(10)4-6(9(13)14)5(2)8(11)12/h6H,2-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | SNZASURHPHUILL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|