C16H22N2O5 — CID 175501075
methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]oxypyridine-2-carboxylate (PubChem CID 175501075) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]oxypyridine-2-carboxylate.
| Compound Name | methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]oxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 175501075 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]oxypyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(OC2(NC(=O)OC(C)(C)C)CCC2)cn1 |
| InChI | InChI=1S/C16H22N2O5/c1-15(2,3)23-14(20)18-16(8-5-9-16)22-11-6-7-12(17-10-11)13(19)21-4/h6-7,10H,5,8-9H2,1-4H3,(H,18,20) |
| InChIKey | IAGFZFQURIQXIM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|