C20H18N2O4 — CID 175501610
benzyl 1-(dihydroxymethyl)-2,3-dihydro-1H-pyrido[3,4-b]indole-4-carboxylate (PubChem CID 175501610) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is benzyl 1-(dihydroxymethyl)-2,3-dihydro-1H-pyrido[3,4-b]indole-4-carboxylate.
| Compound Name | benzyl 1-(dihydroxymethyl)-2,3-dihydro-1H-pyrido[3,4-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 175501610 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | benzyl 1-(dihydroxymethyl)-2,3-dihydro-1H-pyrido[3,4-b]indole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1=C2C(=Nc3ccccc32)C(C(O)O)NC1 |
| InChI | InChI=1S/C20H18N2O4/c23-19(24)18-17-16(13-8-4-5-9-15(13)22-17)14(10-21-18)20(25)26-11-12-6-2-1-3-7-12/h1-9,18-19,21,23-24H,10-11H2 |
| InChIKey | PPXIEGFDWJXWKA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|