C23H22N2O4 — CID 141421309
benzyl 1-(2,2-dimethoxyethyl)-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 141421309) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is benzyl 1-(2,2-dimethoxyethyl)-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | benzyl 1-(2,2-dimethoxyethyl)-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 141421309 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | benzyl 1-(2,2-dimethoxyethyl)-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(CC1N=C(C(=O)OCc2ccccc2)C=C2C1=Nc1ccccc12)OC |
| InChI | InChI=1S/C23H22N2O4/c1-27-21(28-2)13-19-22-17(16-10-6-7-11-18(16)25-22)12-20(24-19)23(26)29-14-15-8-4-3-5-9-15/h3-12,19,21H,13-14H2,1-2H3 |
| InChIKey | XDXOYFWDIUBBNM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|