C11H29N3O — CID 175505352
4-aminobutan-1-ol;1-N,1-N,2-N,2-N-tetramethylpropane-1,2-diamine (PubChem CID 175505352) has the molecular formula C11H29N3O and a molecular weight of 219.37 g/mol. Its IUPAC name is 4-aminobutan-1-ol;1-N,1-N,2-N,2-N-tetramethylpropane-1,2-diamine.
| Compound Name | 4-aminobutan-1-ol;1-N,1-N,2-N,2-N-tetramethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 175505352 |
| Molecular Formula | C11H29N3O |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.23 |
| IUPAC Name | 4-aminobutan-1-ol;1-N,1-N,2-N,2-N-tetramethylpropane-1,2-diamine |
| SMILES | CC(CN(C)C)N(C)C.NCCCCO |
| InChI | InChI=1S/C7H18N2.C4H11NO/c1-7(9(4)5)6-8(2)3;5-3-1-2-4-6/h7H,6H2,1-5H3;6H,1-5H2 |
| InChIKey | ULWPLSBIMOFKMV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|