About sodium (2-aminonaphthalen-1-yl) sulfate
sodium (2-aminonaphthalen-1-yl) sulfate (PubChem CID 175508188) has the molecular formula C10H8NNaO4S
and a molecular weight of 261.23 g/mol. Its IUPAC name is sodium (2-aminonaphthalen-1-yl) sulfate.
Molecular Properties
| Compound Name | sodium (2-aminonaphthalen-1-yl) sulfate |
| PubChem CID | 175508188 |
| Molecular Formula | C10H8NNaO4S |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | sodium (2-aminonaphthalen-1-yl) sulfate |
| SMILES | Nc1ccc2ccccc2c1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H9NO4S.Na/c11-9-6-5-7-3-1-2-4-8(7)10(9)15-16(12,13)14;/h1-6H,11H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | LKYIWXACUQGRMU-UHFFFAOYSA-M |
| XLogP | -1.74 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium (2-aminonaphthalen-1-yl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2-aminonaphthalen-1-yl) sulfate?
The IUPAC name of sodium (2-aminonaphthalen-1-yl) sulfate (CID 175508188) is sodium (2-aminonaphthalen-1-yl) sulfate.
What is the SMILES notation for sodium (2-aminonaphthalen-1-yl) sulfate?
The canonical SMILES for sodium (2-aminonaphthalen-1-yl) sulfate is Nc1ccc2ccccc2c1OS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium (2-aminonaphthalen-1-yl) sulfate?
The InChIKey is LKYIWXACUQGRMU-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO4S.Na/c11-9-6-5-7-3-1-2-4-8(7)10(9)15-16(12,13)14;/h1-6H,11H2,(H,12,13,14);/q;+1/p-1.
What are the key properties of sodium (2-aminonaphthalen-1-yl) sulfate?
sodium (2-aminonaphthalen-1-yl) sulfate has a molecular weight of 261.23 g/mol, XLogP of -1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2-aminonaphthalen-1-yl) sulfate is sourced from PubChem (CID 175508188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).